CAS 84461-60-9 is the registry number for 3',6'-Dihydroxy-5-mercapto-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3',6'-dihydroxy-6-sulfanylspiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 84461-60-9) is a chemical compound with the molecular formula C20H12O5S and a molecular weight of 364.4 g/mol. IUPAC name: 3',6'-dihydroxy-6-sulfanylspiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: QNSJMGVNMDPJTG-UHFFFAOYSA-N.
| Molecular formula | C20H12O5S |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 3',6'-dihydroxy-6-sulfanylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | QNSJMGVNMDPJTG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)OC3=C(C24C5=C(C=C(C=C5)S)C(=O)O4)C=CC(=C3)O |
Computed by PubChem (NCBI)