Products 844639-57-2
CAS 844639-57-2 appears in our catalog under these names: CAY10471 Racemate, CAY10471 (Racemate), 99.00%, CAY10471 (Racemate). Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 25 mg, 10 mg.
2-[3-[(4-fluorophenyl)sulfonyl-methylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid (CAS 844639-57-2) is a chemical compound with the molecular formula C21H21FN2O4S and a molecular weight of 416.5 g/mol. IUPAC name: 2-[3-[(4-fluorophenyl)sulfonyl-methylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid. InChIKey: CANCTKXGRVNXFP-UHFFFAOYSA-N.
| Molecular formula | C21H21FN2O4S |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | 2-[3-[(4-fluorophenyl)sulfonyl-methylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
| InChIKey | CANCTKXGRVNXFP-UHFFFAOYSA-N |
| SMILES | CN(C1CCC2=C(C1)C3=CC=CC=C3N2CC(=O)O)S(=O)(=O)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)