CAS 844645-08-5 is the registry number for JNJ-26070109, 99.25%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 100 mg, 5 mg, 50 mg, 10mM/1mL.
4-bromo-N-[(1R)-1-(2,4-difluorophenyl)ethyl]-2-(quinoxalin-5-ylsulfonylamino)benzamide (CAS 844645-08-5) is a chemical compound with the molecular formula C23H17BrF2N4O3S and a molecular weight of 547.4 g/mol. IUPAC name: 4-bromo-N-[(1R)-1-(2,4-difluorophenyl)ethyl]-2-(quinoxalin-5-ylsulfonylamino)benzamide. InChIKey: TZKCPFFVWLRNRZ-CYBMUJFWSA-N.
| Molecular formula | C23H17BrF2N4O3S |
|---|---|
| Molecular weight | 547.4 g/mol |
| IUPAC name | 4-bromo-N-[(1R)-1-(2,4-difluorophenyl)ethyl]-2-(quinoxalin-5-ylsulfonylamino)benzamide |
| InChIKey | TZKCPFFVWLRNRZ-CYBMUJFWSA-N |
| SMILES | C[C@H](C1=C(C=C(C=C1)F)F)NC(=O)C2=C(C=C(C=C2)Br)NS(=O)(=O)C3=CC=CC4=NC=CN=C43 |
Computed by PubChem (NCBI)