CAS 844665-21-0 is the registry number for N-Ethylaniline-d5. Offered by: TRC. Available pack sizes: 5g.
N-(1,1,2,2,2-pentadeuterioethyl)aniline (CAS 844665-21-0) is a chemical compound with the molecular formula C8H11N and a molecular weight of 126.21 g/mol. IUPAC name: N-(1,1,2,2,2-pentadeuterioethyl)aniline. InChIKey: OJGMBLNIHDZDGS-ZBJDZAJPSA-N.
| Molecular formula | C8H11N |
|---|---|
| Molecular weight | 126.21 g/mol |
| IUPAC name | N-(1,1,2,2,2-pentadeuterioethyl)aniline |
| InChIKey | OJGMBLNIHDZDGS-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])NC1=CC=CC=C1 |
Computed by PubChem (NCBI)