Products 844681-29-4

CAS 844681-29-4 is the registry number for 8-(Ethylsulfonylamino)octanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

8-(ethylsulfonylamino)octanoic acid (CAS 844681-29-4) is a chemical compound with the molecular formula C10H21NO4S and a molecular weight of 251.35 g/mol. IUPAC name: 8-(ethylsulfonylamino)octanoic acid. InChIKey: ARMWXQNVXNYDBI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H21NO4S
Molecular weight251.35 g/mol
IUPAC name8-(ethylsulfonylamino)octanoic acid
InChIKeyARMWXQNVXNYDBI-UHFFFAOYSA-N
SMILESCCS(=O)(=O)NCCCCCCCC(=O)O

Computed by PubChem (NCBI)