CAS 84485-08-5 appears in our catalog under these names: Chloro-Sibutramine HCl, Chloro-sibutramine hydrochloride, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 5mg.
1-[1-(3,4-dichlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrochloride (CAS 84485-08-5) is a chemical compound with the molecular formula C17H26Cl3N and a molecular weight of 350.7 g/mol. IUPAC name: 1-[1-(3,4-dichlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrochloride. InChIKey: RTMMDRRRGLBKDZ-UHFFFAOYSA-N.
| Molecular formula | C17H26Cl3N |
|---|---|
| Molecular weight | 350.7 g/mol |
| IUPAC name | 1-[1-(3,4-dichlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrochloride |
| InChIKey | RTMMDRRRGLBKDZ-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C1(CCC1)C2=CC(=C(C=C2)Cl)Cl)N(C)C.Cl |
Computed by PubChem (NCBI)