CAS 844850-00-6 is the registry number for Ethyl 3-(4-bromo-2,6-difluorophenyl)-2-methylacrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl (E)-3-(4-bromo-2,6-difluorophenyl)-2-methylprop-2-enoate (CAS 844850-00-6) is a chemical compound with the molecular formula C12H11BrF2O2 and a molecular weight of 305.11 g/mol. IUPAC name: ethyl (E)-3-(4-bromo-2,6-difluorophenyl)-2-methylprop-2-enoate. InChIKey: AMRTXRWRGAVICX-QPJJXVBHSA-N.
| Molecular formula | C12H11BrF2O2 |
|---|---|
| Molecular weight | 305.11 g/mol |
| IUPAC name | ethyl (E)-3-(4-bromo-2,6-difluorophenyl)-2-methylprop-2-enoate |
| InChIKey | AMRTXRWRGAVICX-QPJJXVBHSA-N |
| SMILES | CCOC(=O)/C(=C/C1=C(C=C(C=C1F)Br)F)/C |
Computed by PubChem (NCBI)