CAS 84487-04-7 appears in our catalog under these names: 6–bromo–3–nitropyridin–2–amine, 2-Amino-6-bromo-3-nitropyridine 95%, 6-Bromo-3-nitropyridin-2-amine, 96%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 10g, 100g.
6-bromo-3-nitropyridin-2-amine (CAS 84487-04-7) is a chemical compound with the molecular formula C5H4BrN3O2 and a molecular weight of 218.01 g/mol. IUPAC name: 6-bromo-3-nitropyridin-2-amine. InChIKey: YRXZIHANXVKUHP-UHFFFAOYSA-N.
| Molecular formula | C5H4BrN3O2 |
|---|---|
| Molecular weight | 218.01 g/mol |
| IUPAC name | 6-bromo-3-nitropyridin-2-amine |
| InChIKey | YRXZIHANXVKUHP-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1[N+](=O)[O-])N)Br |
Computed by PubChem (NCBI)