CAS 844874-18-6 appears in our catalog under these names: (1R,2S,4R,5S)-3-Oxatricyclo(3.2.1.02,4)octane, 98%, Rac-(1r,2s,4r,5s)-3-oxatricyclo[3.2.1.0,2,4]octane, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 1g.
(1R,2S,4R,5S)-3-oxatricyclo[3.2.1.02,4]octane (CAS 844874-18-6) is a chemical compound with the molecular formula C7H10O and a molecular weight of 110.15 g/mol. IUPAC name: (1R,2S,4R,5S)-3-oxatricyclo[3.2.1.02,4]octane. InChIKey: OHNNZOOGWXZCPZ-RNGGSSJXSA-N.
| Molecular formula | C7H10O |
|---|---|
| Molecular weight | 110.15 g/mol |
| IUPAC name | (1R,2S,4R,5S)-3-oxatricyclo[3.2.1.02,4]octane |
| InChIKey | OHNNZOOGWXZCPZ-RNGGSSJXSA-N |
| SMILES | C1C[C@H]2C[C@@H]1[C@H]3[C@@H]2O3 |
Computed by PubChem (NCBI)