Products 844885-05-8
CAS 844885-05-8 is the registry number for 4-Chloro-3'-fluoro-4'-methoxybenzophenone, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
(4-chlorophenyl)-(3-fluoro-4-methoxyphenyl)methanone (CAS 844885-05-8) is a chemical compound with the molecular formula C14H10ClFO2 and a molecular weight of 264.68 g/mol. IUPAC name: (4-chlorophenyl)-(3-fluoro-4-methoxyphenyl)methanone. InChIKey: NKZCFJJKOCNILS-UHFFFAOYSA-N.
| Molecular formula | C14H10ClFO2 |
|---|---|
| Molecular weight | 264.68 g/mol |
| IUPAC name | (4-chlorophenyl)-(3-fluoro-4-methoxyphenyl)methanone |
| InChIKey | NKZCFJJKOCNILS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)C2=CC=C(C=C2)Cl)F |
Computed by PubChem (NCBI)