CAS 84494-81-5 appears in our catalog under these names: P–(T–BUTYLDIMETHYLSILOXY)STYRENE, tert-butyl(4-ethenylphenoxy)dimethylsilane, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 10g.
Tert-butyl-(4-ethenylphenoxy)-dimethylsilane (CAS 84494-81-5) is a chemical compound with the molecular formula C14H22OSi and a molecular weight of 234.41 g/mol. IUPAC name: tert-butyl-(4-ethenylphenoxy)-dimethylsilane. InChIKey: QVPBMCKCBQURHP-UHFFFAOYSA-N.
| Molecular formula | C14H22OSi |
|---|---|
| Molecular weight | 234.41 g/mol |
| IUPAC name | tert-butyl-(4-ethenylphenoxy)-dimethylsilane |
| InChIKey | QVPBMCKCBQURHP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC=C(C=C1)C=C |
Computed by PubChem (NCBI)