CAS 845-30-7 is the registry number for 3-Chlorobenzoic peroxyanhydride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-chlorobenzoyl) 3-chlorobenzenecarboperoxoate (CAS 845-30-7) is a chemical compound with the molecular formula C14H8Cl2O4 and a molecular weight of 311.1 g/mol. IUPAC name: (3-chlorobenzoyl) 3-chlorobenzenecarboperoxoate. InChIKey: XBDOGXHLESIJJK-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2O4 |
|---|---|
| Molecular weight | 311.1 g/mol |
| IUPAC name | (3-chlorobenzoyl) 3-chlorobenzenecarboperoxoate |
| InChIKey | XBDOGXHLESIJJK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(=O)OOC(=O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)