Products 845-30-7

CAS 845-30-7 is the registry number for 3-Chlorobenzoic peroxyanhydride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3-chlorobenzoyl) 3-chlorobenzenecarboperoxoate (CAS 845-30-7) is a chemical compound with the molecular formula C14H8Cl2O4 and a molecular weight of 311.1 g/mol. IUPAC name: (3-chlorobenzoyl) 3-chlorobenzenecarboperoxoate. InChIKey: XBDOGXHLESIJJK-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8Cl2O4
Molecular weight311.1 g/mol
IUPAC name(3-chlorobenzoyl) 3-chlorobenzenecarboperoxoate
InChIKeyXBDOGXHLESIJJK-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)Cl)C(=O)OOC(=O)C2=CC(=CC=C2)Cl

Computed by PubChem (NCBI)