CAS 84532-72-9 appears in our catalog under these names: 6-Methoxy-5-(trifluoromethyl)-1-naphthoic acid, 96%, 6-Methoxy-5-(trifluoromethyl)-1-naphthalenecarboxylic acid, 96%, 96%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
6-methoxy-5-(trifluoromethyl)naphthalene-1-carboxylic acid (CAS 84532-72-9) is a chemical compound with the molecular formula C13H9F3O3 and a molecular weight of 270.20 g/mol. IUPAC name: 6-methoxy-5-(trifluoromethyl)naphthalene-1-carboxylic acid. InChIKey: AEBBCDMWPOXGSG-UHFFFAOYSA-N.
| Molecular formula | C13H9F3O3 |
|---|---|
| Molecular weight | 270.20 g/mol |
| IUPAC name | 6-methoxy-5-(trifluoromethyl)naphthalene-1-carboxylic acid |
| InChIKey | AEBBCDMWPOXGSG-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C(=CC=C2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)