Products 84540-64-7

CAS 84540-64-7 is the registry number for Succinic acid (tromethamine). Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

Bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);butanedioic acid (CAS 84540-64-7) is a chemical compound with the molecular formula C12H28N2O10 and a molecular weight of 360.36 g/mol. IUPAC name: bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);butanedioic acid. InChIKey: CFJZQNZZGQDONE-UHFFFAOYSA-N.

Identity
Molecular formulaC12H28N2O10
Molecular weight360.36 g/mol
IUPAC namebis(2-amino-2-(hydroxymethyl)propane-1,3-diol);butanedioic acid
InChIKeyCFJZQNZZGQDONE-UHFFFAOYSA-N
SMILESC(CC(=O)O)C(=O)O.C(C(CO)(CO)N)O.C(C(CO)(CO)N)O

Computed by PubChem (NCBI)