Products 845616-92-4
CAS 845616-92-4 is the registry number for 1-(4-Trifluoromethanesulfonylphenyl)piperazine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[4-(trifluoromethylsulfonyl)phenyl]piperazine (CAS 845616-92-4) is a chemical compound with the molecular formula C11H13F3N2O2S and a molecular weight of 294.30 g/mol. IUPAC name: 1-[4-(trifluoromethylsulfonyl)phenyl]piperazine. InChIKey: ANLJCXQUPUPXST-UHFFFAOYSA-N.
| Molecular formula | C11H13F3N2O2S |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | 1-[4-(trifluoromethylsulfonyl)phenyl]piperazine |
| InChIKey | ANLJCXQUPUPXST-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)S(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)