CAS 845644-47-5 appears in our catalog under these names: 5-Fluoro-2,3-dihydrobenzo(d)isothiazole 1,1-dioxide, 95+%, 5-Fluoro-2,3-dihydro-1,2-benzothiazole-1,1-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-fluoro-2,3-dihydro-1,2-benzothiazole 1,1-dioxide (CAS 845644-47-5) is a chemical compound with the molecular formula C7H6FNO2S and a molecular weight of 187.19 g/mol. IUPAC name: 5-fluoro-2,3-dihydro-1,2-benzothiazole 1,1-dioxide. InChIKey: UGYJNSPJVSELQO-UHFFFAOYSA-N.
| Molecular formula | C7H6FNO2S |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 5-fluoro-2,3-dihydro-1,2-benzothiazole 1,1-dioxide |
| InChIKey | UGYJNSPJVSELQO-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)F)S(=O)(=O)N1 |
Computed by PubChem (NCBI)