CAS 845823-17-8 is the registry number for 1-(Trimethylsilyl)-3,5-dimethyl-4-methoxybenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-methoxy-3,5-dimethylphenyl)-trimethylsilane (CAS 845823-17-8) is a chemical compound with the molecular formula C12H20OSi and a molecular weight of 208.37 g/mol. IUPAC name: (4-methoxy-3,5-dimethylphenyl)-trimethylsilane. InChIKey: ZYTZGESMAZLOTC-UHFFFAOYSA-N.
| Molecular formula | C12H20OSi |
|---|---|
| Molecular weight | 208.37 g/mol |
| IUPAC name | (4-methoxy-3,5-dimethylphenyl)-trimethylsilane |
| InChIKey | ZYTZGESMAZLOTC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OC)C)[Si](C)(C)C |
Computed by PubChem (NCBI)