CAS 845895-51-4 is the registry number for AP23464. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[2-[2-cyclopentyl-6-(4-dimethylphosphorylanilino)purin-9-yl]ethyl]phenol (CAS 845895-51-4) is a chemical compound with the molecular formula C26H30N5O2P and a molecular weight of 475.5 g/mol. IUPAC name: 3-[2-[2-cyclopentyl-6-(4-dimethylphosphorylanilino)purin-9-yl]ethyl]phenol. InChIKey: VVOYROSONSLQQK-UHFFFAOYSA-N.
| Molecular formula | C26H30N5O2P |
|---|---|
| Molecular weight | 475.5 g/mol |
| IUPAC name | 3-[2-[2-cyclopentyl-6-(4-dimethylphosphorylanilino)purin-9-yl]ethyl]phenol |
| InChIKey | VVOYROSONSLQQK-UHFFFAOYSA-N |
| SMILES | CP(=O)(C)C1=CC=C(C=C1)NC2=C3C(=NC(=N2)C4CCCC4)N(C=N3)CCC5=CC(=CC=C5)O |
Computed by PubChem (NCBI)