CAS 845930-79-2 appears in our catalog under these names: (R)-1-(4-Bromo-2-fluorophenyl)ethanamine, 97%, (R)-1-(4-Bromo-2-fluorophenyl)ethanamine 95%, (R)-1-(4-BROMO-2-FLUOROPHENYL)ETHANAMINE, 95%, 95%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(1R)-1-(4-bromo-2-fluorophenyl)ethanamine (CAS 845930-79-2) is a chemical compound with the molecular formula C8H9BrFN and a molecular weight of 218.07 g/mol. IUPAC name: (1R)-1-(4-bromo-2-fluorophenyl)ethanamine. InChIKey: BRPFKIPSXUHGSH-RXMQYKEDSA-N.
| Molecular formula | C8H9BrFN |
|---|---|
| Molecular weight | 218.07 g/mol |
| IUPAC name | (1R)-1-(4-bromo-2-fluorophenyl)ethanamine |
| InChIKey | BRPFKIPSXUHGSH-RXMQYKEDSA-N |
| SMILES | C[C@H](C1=C(C=C(C=C1)Br)F)N |
Computed by PubChem (NCBI)