CAS 846033-02-1 is the registry number for 7-Chloro-3,4-dihydronaphthalen-1-yl trifluoromethanesulfonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(7-chloro-3,4-dihydronaphthalen-1-yl) trifluoromethanesulfonate (CAS 846033-02-1) is a chemical compound with the molecular formula C11H8ClF3O3S and a molecular weight of 312.69 g/mol. IUPAC name: (7-chloro-3,4-dihydronaphthalen-1-yl) trifluoromethanesulfonate. InChIKey: FQHQPUYLWXRJGM-UHFFFAOYSA-N.
| Molecular formula | C11H8ClF3O3S |
|---|---|
| Molecular weight | 312.69 g/mol |
| IUPAC name | (7-chloro-3,4-dihydronaphthalen-1-yl) trifluoromethanesulfonate |
| InChIKey | FQHQPUYLWXRJGM-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)Cl)C(=C1)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)