CAS 846033-28-1 is the registry number for tert-Butyl 4-(4-bromonaphthalen-1-yl)piperazine-1-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Tert-butyl 4-(4-bromonaphthalen-1-yl)piperazine-1-carboxylate (CAS 846033-28-1) is a chemical compound with the molecular formula C19H23BrN2O2 and a molecular weight of 391.3 g/mol. IUPAC name: tert-butyl 4-(4-bromonaphthalen-1-yl)piperazine-1-carboxylate. InChIKey: UDKJOXLBVXZYEW-UHFFFAOYSA-N.
| Molecular formula | C19H23BrN2O2 |
|---|---|
| Molecular weight | 391.3 g/mol |
| IUPAC name | tert-butyl 4-(4-bromonaphthalen-1-yl)piperazine-1-carboxylate |
| InChIKey | UDKJOXLBVXZYEW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC=C(C3=CC=CC=C32)Br |
Computed by PubChem (NCBI)