CAS 84632-59-7 is the registry number for Pigment Orange 73. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-bis(4-tert-butylphenyl)-3-hydroxy-2H-pyrrolo[3,4-c]pyrrol-6-one (CAS 84632-59-7) is a chemical compound with the molecular formula C26H28N2O2 and a molecular weight of 400.5 g/mol. IUPAC name: 1,4-bis(4-tert-butylphenyl)-3-hydroxy-2H-pyrrolo[3,4-c]pyrrol-6-one. InChIKey: LUWZMQBKBJUDAU-UHFFFAOYSA-N.
| Molecular formula | C26H28N2O2 |
|---|---|
| Molecular weight | 400.5 g/mol |
| IUPAC name | 1,4-bis(4-tert-butylphenyl)-3-hydroxy-2H-pyrrolo[3,4-c]pyrrol-6-one |
| InChIKey | LUWZMQBKBJUDAU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=C3C(=C(N2)O)C(=NC3=O)C4=CC=C(C=C4)C(C)(C)C |
Computed by PubChem (NCBI)