CAS 84632-65-5 appears in our catalog under these names: 3,6-Bis(4-chlorophenyl)-2,5-dihydropyrrole[3,4-C]pyrrole-1,4-dione, 95%, 3,6-Bis(4-chlorophenyl)pyrrolo(3,4-c)pyrrole-1,4(2H,5H)-dione (Technical Grade), Pigment Red 254, Pigment Red 254, 3,6-Bis(4-chlorophenyl)pyrrolo[3,4-c]pyrrole-1,4(2H,5H)-dione Strength:96-105%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, TCI. Available pack sizes: 25g, 100g, 5g, 1g, 250mg, 500mg, 50mg, 500g.
1,4-bis(4-chlorophenyl)-3-hydroxy-2H-pyrrolo[3,4-c]pyrrol-6-one (CAS 84632-65-5) is a chemical compound with the molecular formula C18H10Cl2N2O2 and a molecular weight of 357.2 g/mol. IUPAC name: 1,4-bis(4-chlorophenyl)-3-hydroxy-2H-pyrrolo[3,4-c]pyrrol-6-one. InChIKey: IWCLHLSTAOEFCW-UHFFFAOYSA-N.
| Molecular formula | C18H10Cl2N2O2 |
|---|---|
| Molecular weight | 357.2 g/mol |
| IUPAC name | 1,4-bis(4-chlorophenyl)-3-hydroxy-2H-pyrrolo[3,4-c]pyrrol-6-one |
| InChIKey | IWCLHLSTAOEFCW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C3C(=C(N2)O)C(=NC3=O)C4=CC=C(C=C4)Cl)Cl |
Computed by PubChem (NCBI)