Products 84638-81-3
CAS 84638-81-3 appears in our catalog under these names: ZK-90055 hydrochloride/ 99.67% (existing batch purity), ZK–90055 hydrochloride, ZK-90055 hydrochloride, ZK-90055 (hydrochloride). Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg.
Methyl 4-[2-(tert-butylamino)-1-hydroxyethyl]-7-hydroxy-1H-indole-2-carboxylate;hydrochloride (CAS 84638-81-3) is a chemical compound with the molecular formula C16H23ClN2O4 and a molecular weight of 342.82 g/mol. IUPAC name: methyl 4-[2-(tert-butylamino)-1-hydroxyethyl]-7-hydroxy-1H-indole-2-carboxylate;hydrochloride. InChIKey: BZVWFZUVKYWJCH-UHFFFAOYSA-N.
| Molecular formula | C16H23ClN2O4 |
|---|---|
| Molecular weight | 342.82 g/mol |
| IUPAC name | methyl 4-[2-(tert-butylamino)-1-hydroxyethyl]-7-hydroxy-1H-indole-2-carboxylate;hydrochloride |
| InChIKey | BZVWFZUVKYWJCH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(C1=C2C=C(NC2=C(C=C1)O)C(=O)OC)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
orb1708174