CAS 84682-23-5 appears in our catalog under these names: Ketoconazole Impurity 13, Ketoconazole Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methanol (CAS 84682-23-5) is a chemical compound with the molecular formula C14H14Cl2N2O3 and a molecular weight of 329.2 g/mol. IUPAC name: [2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methanol. InChIKey: VJZJGRMLFMJRGG-UHFFFAOYSA-N.
| Molecular formula | C14H14Cl2N2O3 |
|---|---|
| Molecular weight | 329.2 g/mol |
| IUPAC name | [2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methanol |
| InChIKey | VJZJGRMLFMJRGG-UHFFFAOYSA-N |
| SMILES | C1C(OC(O1)(CN2C=CN=C2)C3=C(C=C(C=C3)Cl)Cl)CO |
Computed by PubChem (NCBI)