CAS 84682-33-7 appears in our catalog under these names: N-(4,4’-Dinitro-biphenyl-2-yl)benzamide, N-(4,4'-Dinitro-[1,1'-biphenyl]-2-yl)benzamide, 95%, 95%. Offered by: TRC, Chemat. Available pack sizes: 1g, 250mg, 500mg, 100mg.
N-[5-nitro-2-(4-nitrophenyl)phenyl]benzamide (CAS 84682-33-7) is a chemical compound with the molecular formula C19H13N3O5 and a molecular weight of 363.3 g/mol. IUPAC name: N-[5-nitro-2-(4-nitrophenyl)phenyl]benzamide. InChIKey: SXHSXUJZDOVNJP-UHFFFAOYSA-N.
| Molecular formula | C19H13N3O5 |
|---|---|
| Molecular weight | 363.3 g/mol |
| IUPAC name | N-[5-nitro-2-(4-nitrophenyl)phenyl]benzamide |
| InChIKey | SXHSXUJZDOVNJP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=C(C=CC(=C2)[N+](=O)[O-])C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)