CAS 847158-84-3 is the registry number for 3-(Dimethylphenylsilyl)-cyclobutanone. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
3-[dimethyl(phenyl)silyl]cyclobutan-1-one (CAS 847158-84-3) is a chemical compound with the molecular formula C12H16OSi and a molecular weight of 204.34 g/mol. IUPAC name: 3-[dimethyl(phenyl)silyl]cyclobutan-1-one. InChIKey: UCLQUAUTIGIDGZ-UHFFFAOYSA-N.
| Molecular formula | C12H16OSi |
|---|---|
| Molecular weight | 204.34 g/mol |
| IUPAC name | 3-[dimethyl(phenyl)silyl]cyclobutan-1-one |
| InChIKey | UCLQUAUTIGIDGZ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C1CC(=O)C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)