CAS 847158-85-4 is the registry number for 4-Methyl-benzenesulfonic Acid 2-(3-(Dimethylphenylsilyl)cyclobutylidene)hydrazide. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
N-[[3-[dimethyl(phenyl)silyl]cyclobutylidene]amino]-4-methylbenzenesulfonamide (CAS 847158-85-4) is a chemical compound with the molecular formula C19H24N2O2SSi and a molecular weight of 372.6 g/mol. IUPAC name: N-[[3-[dimethyl(phenyl)silyl]cyclobutylidene]amino]-4-methylbenzenesulfonamide. InChIKey: TVGWKNPPKSMNLI-UHFFFAOYSA-N.
| Molecular formula | C19H24N2O2SSi |
|---|---|
| Molecular weight | 372.6 g/mol |
| IUPAC name | N-[[3-[dimethyl(phenyl)silyl]cyclobutylidene]amino]-4-methylbenzenesulfonamide |
| InChIKey | TVGWKNPPKSMNLI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NN=C2CC(C2)[Si](C)(C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)