CAS 847199-27-3 is the registry number for methyl 4-((tert-butyldimethylsilyl)oxy)-2-hydroxybutanoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl 4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxybutanoate (CAS 847199-27-3) is a chemical compound with the molecular formula C11H24O4Si and a molecular weight of 248.39 g/mol. IUPAC name: methyl 4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxybutanoate. InChIKey: DCLHQXCUVDZBNE-UHFFFAOYSA-N.
| Molecular formula | C11H24O4Si |
|---|---|
| Molecular weight | 248.39 g/mol |
| IUPAC name | methyl 4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxybutanoate |
| InChIKey | DCLHQXCUVDZBNE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCCC(C(=O)OC)O |
Computed by PubChem (NCBI)