CAS 847226-00-0 appears in our catalog under these names: 3-Chloro-2-(4-fluorophenyl)pyridine, 95%, 3-Chloro-2-(4-fluorophenyl)pyridine. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
3-chloro-2-(4-fluorophenyl)pyridine (CAS 847226-00-0) is a chemical compound with the molecular formula C11H7ClFN and a molecular weight of 207.63 g/mol. IUPAC name: 3-chloro-2-(4-fluorophenyl)pyridine. InChIKey: XUWFWHJZZONRCE-UHFFFAOYSA-N.
| Molecular formula | C11H7ClFN |
|---|---|
| Molecular weight | 207.63 g/mol |
| IUPAC name | 3-chloro-2-(4-fluorophenyl)pyridine |
| InChIKey | XUWFWHJZZONRCE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C2=CC=C(C=C2)F)Cl |
Computed by PubChem (NCBI)