Products 847353-30-4
CAS 847353-30-4 is the registry number for Arbaclofen placarbil. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R)-3-(4-chlorophenyl)-4-[[(1S)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]butanoic acid (CAS 847353-30-4) is a chemical compound with the molecular formula C19H26ClNO6 and a molecular weight of 399.9 g/mol. IUPAC name: (3R)-3-(4-chlorophenyl)-4-[[(1S)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]butanoic acid. InChIKey: JXTAALBWJQJLGN-KSSFIOAISA-N.
| Molecular formula | C19H26ClNO6 |
|---|---|
| Molecular weight | 399.9 g/mol |
| IUPAC name | (3R)-3-(4-chlorophenyl)-4-[[(1S)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]butanoic acid |
| InChIKey | JXTAALBWJQJLGN-KSSFIOAISA-N |
| SMILES | CC(C)[C@@H](OC(=O)C(C)C)OC(=O)NC[C@H](CC(=O)O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)