CAS 84737-23-5 is the registry number for 2,4,5–Trichloro–6–(trifluoromethyl)pyrimidine. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
2,4,5-trichloro-6-(trifluoromethyl)pyrimidine (CAS 84737-23-5) is a chemical compound with the molecular formula C5Cl3F3N2 and a molecular weight of 251.42 g/mol. IUPAC name: 2,4,5-trichloro-6-(trifluoromethyl)pyrimidine. InChIKey: FRINPQMOLZWJHY-UHFFFAOYSA-N.
| Molecular formula | C5Cl3F3N2 |
|---|---|
| Molecular weight | 251.42 g/mol |
| IUPAC name | 2,4,5-trichloro-6-(trifluoromethyl)pyrimidine |
| InChIKey | FRINPQMOLZWJHY-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(N=C1Cl)Cl)C(F)(F)F)Cl |
Computed by PubChem (NCBI)