CAS 84743-75-9 appears in our catalog under these names: 2,4-Dibromobenzene-1,3,5-triol, 95%, 2,4–Dibromobenzene–1,3,5–triol, 2,4-dibroMobenzene-1,3,5-triol/ 98.45% (existing batch purity), 2,4-Dibromobenzene-1,3,5-triol 97%, 2,4-Dibromobenzene-1,3,5-triol, 97%. Offered by: Combi-blocks, GLPBio, TargetMol, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5mg, 10mg, 25mg, 50mg, 200mg.
2,4-dibromobenzene-1,3,5-triol (CAS 84743-75-9) is a chemical compound with the molecular formula C6H4Br2O3 and a molecular weight of 283.90 g/mol. IUPAC name: 2,4-dibromobenzene-1,3,5-triol. InChIKey: SNZHHFHFCLIISK-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2O3 |
|---|---|
| Molecular weight | 283.90 g/mol |
| IUPAC name | 2,4-dibromobenzene-1,3,5-triol |
| InChIKey | SNZHHFHFCLIISK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1O)Br)O)Br)O |
Computed by PubChem (NCBI)