CAS 84750-88-9 appears in our catalog under these names: Dimethyl perfluoro-1,10-decanedicarboxylate, 96%, Dimethyl Perfluoro-1,10-decanedicarboxylate (~90%), Dimethyl perfluoro-1,10-decanedicarboxylate. Offered by: Combi-blocks, TRC, HPC Standards. Available pack sizes: 5g, 100g, 25g, 1g, 100mg, 500mg, 50mg, 1x10mg.
Dimethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluorododecanedioate (CAS 84750-88-9) is a chemical compound with the molecular formula C14H6F20O4 and a molecular weight of 618.16 g/mol. IUPAC name: dimethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluorododecanedioate. InChIKey: GHVIUCXUOSDTBP-UHFFFAOYSA-N.
| Molecular formula | C14H6F20O4 |
|---|---|
| Molecular weight | 618.16 g/mol |
| IUPAC name | dimethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluorododecanedioate |
| InChIKey | GHVIUCXUOSDTBP-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(C(C(C(C(C(C(C(C(C(=O)OC)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)