Products 847553-89-3
CAS 847553-89-3 appears in our catalog under these names: SHA 68, SHA 68, SHA 68, 99.84%, SHA 68 (Standard), SHA 68, 99%. Offered by: GLPBio, Biosynth, MedChemExpress, Ambeed, BLDpharm. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 50mg, 100mg, 10mM/1mL, 25 mg.
N-[(4-fluorophenyl)methyl]-3-oxo-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide (CAS 847553-89-3) is a chemical compound with the molecular formula C26H24FN3O3 and a molecular weight of 445.5 g/mol. IUPAC name: N-[(4-fluorophenyl)methyl]-3-oxo-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide. InChIKey: SFRQIPRTNYHJHP-UHFFFAOYSA-N.
| Molecular formula | C26H24FN3O3 |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | N-[(4-fluorophenyl)methyl]-3-oxo-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide |
| InChIKey | SFRQIPRTNYHJHP-UHFFFAOYSA-N |
| SMILES | C1CN2C(CN1C(=O)NCC3=CC=C(C=C3)F)C(OC2=O)(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)