CAS 847588-86-7 appears in our catalog under these names: Bendamustine Impurity 73, 2,2'-(1,3-Propanediyl)bis(1-methyl-1H-benzimidazol-5-amine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
2-[3-(5-amino-1-methylbenzimidazol-2-yl)propyl]-1-methylbenzimidazol-5-amine (CAS 847588-86-7) is a chemical compound with the molecular formula C19H22N6 and a molecular weight of 334.4 g/mol. IUPAC name: 2-[3-(5-amino-1-methylbenzimidazol-2-yl)propyl]-1-methylbenzimidazol-5-amine. InChIKey: LFSQICCVDIAHQT-UHFFFAOYSA-N.
| Molecular formula | C19H22N6 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 2-[3-(5-amino-1-methylbenzimidazol-2-yl)propyl]-1-methylbenzimidazol-5-amine |
| InChIKey | LFSQICCVDIAHQT-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)N)N=C1CCCC3=NC4=C(N3C)C=CC(=C4)N |
Computed by PubChem (NCBI)