CAS 847648-50-4 is the registry number for 2,6-Diamino-9-(2'-O-methyl-b-D-ribofuranosyl)purine. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg, 5000mg.
(2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-ol (CAS 847648-50-4) is a chemical compound with the molecular formula C11H16N6O4 and a molecular weight of 296.28 g/mol. IUPAC name: (2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-ol. InChIKey: JLWUWXCKSOIFPS-PKJMTWSGSA-N.
| Molecular formula | C11H16N6O4 |
|---|---|
| Molecular weight | 296.28 g/mol |
| IUPAC name | (2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-ol |
| InChIKey | JLWUWXCKSOIFPS-PKJMTWSGSA-N |
| SMILES | COC1[C@H]([C@H](O[C@H]1N2C=NC3=C(N=C(N=C32)N)N)CO)O |
Computed by PubChem (NCBI)