CAS 847696-16-6 appears in our catalog under these names: (2S)-N1,N1,3-Trimethyl-1,2-butanediamine dihydrochloride, 95%, (S)-N1,N1,3-Trimethylbutane-1,2-diamine, 97%, (S)-N1,N1,3-Trimethylbutane-1,2-diamine, (2S)-N1,N1,3-Trimethyl-1,2-butanediamine dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
(2S)-1-N,1-N,3-trimethylbutane-1,2-diamine;dihydrochloride (CAS 847696-16-6) is a chemical compound with the molecular formula C7H20Cl2N2 and a molecular weight of 203.15 g/mol. IUPAC name: (2S)-1-N,1-N,3-trimethylbutane-1,2-diamine;dihydrochloride. InChIKey: BQFDXJRMHGZPKD-XCUBXKJBSA-N.
| Molecular formula | C7H20Cl2N2 |
|---|---|
| Molecular weight | 203.15 g/mol |
| IUPAC name | (2S)-1-N,1-N,3-trimethylbutane-1,2-diamine;dihydrochloride |
| InChIKey | BQFDXJRMHGZPKD-XCUBXKJBSA-N |
| SMILES | CC(C)[C@@H](CN(C)C)N.Cl.Cl |
Computed by PubChem (NCBI)