CAS 847837-29-0 is the registry number for 4-(4-Ethoxyphenoxy)benzene-1-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-(4-ethoxyphenoxy)benzenesulfonyl chloride (CAS 847837-29-0) is a chemical compound with the molecular formula C14H13ClO4S and a molecular weight of 312.8 g/mol. IUPAC name: 4-(4-ethoxyphenoxy)benzenesulfonyl chloride. InChIKey: KLIXUELBAKMDHO-UHFFFAOYSA-N.
| Molecular formula | C14H13ClO4S |
|---|---|
| Molecular weight | 312.8 g/mol |
| IUPAC name | 4-(4-ethoxyphenoxy)benzenesulfonyl chloride |
| InChIKey | KLIXUELBAKMDHO-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)OC2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)