CAS 847871-99-2 appears in our catalog under these names: 2,6-Piperidinedione, 3-(4-amino-1,3-dihydro-1-oxo-2H-isoindol-2-yl)-, hydrate (2:1), Lenalidomide hemihydrate, 98%, Lenalidomide hemihydrate/ 100%, Lenalidomide hemihydrate, Lenalidomide (hemihydrate), 99.98%. Offered by: Chemat, AmBeed, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 5mg, 10mg, 250mg, 5g, 1g, 25mg, 100mg, 50mg.
Bis(3-(7-amino-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione);hydrate (CAS 847871-99-2) is a chemical compound with the molecular formula C26H28N6O7 and a molecular weight of 536.5 g/mol. IUPAC name: bis(3-(7-amino-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione);hydrate. InChIKey: OTJHSDXKMBRCMM-UHFFFAOYSA-N.
| Molecular formula | C26H28N6O7 |
|---|---|
| Molecular weight | 536.5 g/mol |
| IUPAC name | bis(3-(7-amino-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione);hydrate |
| InChIKey | OTJHSDXKMBRCMM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC=C3N.C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC=C3N.O |
Computed by PubChem (NCBI)