CAS 847926-89-0 appears in our catalog under these names: 2,2-Dimethyl-3-oxo-3-((2,2,3,3,3-pentafluoropropyl)amino)propanoic acid, 97%, 2，2-Dimethyl-3-Oxo-3-((2，2，3，3，3-Pentafluoropropyl)Amino)Propanoic Acid, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2,2-dimethyl-3-oxo-3-(2,2,3,3,3-pentafluoropropylamino)propanoic acid (CAS 847926-89-0) is a chemical compound with the molecular formula C8H10F5NO3 and a molecular weight of 263.16 g/mol. IUPAC name: 2,2-dimethyl-3-oxo-3-(2,2,3,3,3-pentafluoropropylamino)propanoic acid. InChIKey: ABUVVVBSIOAQES-UHFFFAOYSA-N.
| Molecular formula | C8H10F5NO3 |
|---|---|
| Molecular weight | 263.16 g/mol |
| IUPAC name | 2,2-dimethyl-3-oxo-3-(2,2,3,3,3-pentafluoropropylamino)propanoic acid |
| InChIKey | ABUVVVBSIOAQES-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)NCC(C(F)(F)F)(F)F)C(=O)O |
Computed by PubChem (NCBI)