Products 84807-90-9
CAS 84807-90-9 appears in our catalog under these names: 12(S)–HETE–d8, 12(S)-HETE-d8, 98.00%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 100μg, 25μg, 50μg, 25 μg (304.40 μM * 250 μL in Acetonitrile).
(5Z,8Z,10E,12S,14Z)-5,6,8,9,11,12,14,15-octadeuterio-12-hydroxyicosa-5,8,10,14-tetraenoic acid (CAS 84807-90-9) is a chemical compound with the molecular formula C20H32O3 and a molecular weight of 328.5 g/mol. IUPAC name: (5Z,8Z,10E,12S,14Z)-5,6,8,9,11,12,14,15-octadeuterio-12-hydroxyicosa-5,8,10,14-tetraenoic acid. InChIKey: ZNHVWPKMFKADKW-OPXGWVKSSA-N.
| Molecular formula | C20H32O3 |
|---|---|
| Molecular weight | 328.5 g/mol |
| IUPAC name | (5Z,8Z,10E,12S,14Z)-5,6,8,9,11,12,14,15-octadeuterio-12-hydroxyicosa-5,8,10,14-tetraenoic acid |
| InChIKey | ZNHVWPKMFKADKW-OPXGWVKSSA-N |
| SMILES | [2H]/C(=C(\[2H])/C[C@@]([2H])(/C(=C/C(=C(/[2H])\C/C(=C(/[2H])\CCCC(=O)O)/[2H])/[2H])/[2H])O)/CCCCC |
Computed by PubChem (NCBI)