CAS 848086-93-1 is the registry number for 4,4'-Bis(3-bromo-9H-carbazol-9-yl)-1,1'-biphenyl, >98%, >98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-9-[4-[4-(3-bromocarbazol-9-yl)phenyl]phenyl]carbazole (CAS 848086-93-1) is a chemical compound with the molecular formula C36H22Br2N2 and a molecular weight of 642.4 g/mol. IUPAC name: 3-bromo-9-[4-[4-(3-bromocarbazol-9-yl)phenyl]phenyl]carbazole. InChIKey: PIQLSWNMCZTPKJ-UHFFFAOYSA-N.
| Molecular formula | C36H22Br2N2 |
|---|---|
| Molecular weight | 642.4 g/mol |
| IUPAC name | 3-bromo-9-[4-[4-(3-bromocarbazol-9-yl)phenyl]phenyl]carbazole |
| InChIKey | PIQLSWNMCZTPKJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2C4=CC=C(C=C4)C5=CC=C(C=C5)N6C7=C(C=C(C=C7)Br)C8=CC=CC=C86)C=CC(=C3)Br |
Computed by PubChem (NCBI)