CAS 848178-49-4 is the registry number for Methyl 4-(5-chlorothiophen-2-yl)-2,4-dioxobutanoate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 4-(5-chlorothiophen-2-yl)-2,4-dioxobutanoate (CAS 848178-49-4) is a chemical compound with the molecular formula C9H7ClO4S and a molecular weight of 246.67 g/mol. IUPAC name: methyl 4-(5-chlorothiophen-2-yl)-2,4-dioxobutanoate. InChIKey: PRBFOJLTYZLZGW-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO4S |
|---|---|
| Molecular weight | 246.67 g/mol |
| IUPAC name | methyl 4-(5-chlorothiophen-2-yl)-2,4-dioxobutanoate |
| InChIKey | PRBFOJLTYZLZGW-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=CC=C(S1)Cl |
Computed by PubChem (NCBI)