Products 848290-18-6

CAS 848290-18-6 is the registry number for 4-Chloro-3-([methoxy(methyl)amino]sulfonyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-chloro-3-[methoxy(methyl)sulfamoyl]benzoic acid (CAS 848290-18-6) is a chemical compound with the molecular formula C9H10ClNO5S and a molecular weight of 279.70 g/mol. IUPAC name: 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoic acid. InChIKey: HWTKERCANIFNSG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClNO5S
Molecular weight279.70 g/mol
IUPAC name4-chloro-3-[methoxy(methyl)sulfamoyl]benzoic acid
InChIKeyHWTKERCANIFNSG-UHFFFAOYSA-N
SMILESCN(OC)S(=O)(=O)C1=C(C=CC(=C1)C(=O)O)Cl

Computed by PubChem (NCBI)