Products 848344-36-5
CAS 848344-36-5 appears in our catalog under these names: Bentamapimod, Bentamapimod/ 95.21% (existing batch purity), AS 602801, Bentamapimod 98%, Bentamapimod, 99.23%. Offered by: TRC, TargetMol, GLPBio, Chemat, Ambeed. Available pack sizes: 100mg, 1g, 2g, 2mg, 5mg, 10mg, 25mg, 50mg.
2-(1,3-benzothiazol-2-yl)-2-[2-[[4-(morpholin-4-ylmethyl)phenyl]methoxy]pyrimidin-4-yl]acetonitrile (CAS 848344-36-5) is a chemical compound with the molecular formula C25H23N5O2S and a molecular weight of 457.5 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-yl)-2-[2-[[4-(morpholin-4-ylmethyl)phenyl]methoxy]pyrimidin-4-yl]acetonitrile. InChIKey: XCPPIJCBCWUBNT-UHFFFAOYSA-N.
| Molecular formula | C25H23N5O2S |
|---|---|
| Molecular weight | 457.5 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yl)-2-[2-[[4-(morpholin-4-ylmethyl)phenyl]methoxy]pyrimidin-4-yl]acetonitrile |
| InChIKey | XCPPIJCBCWUBNT-UHFFFAOYSA-N |
| SMILES | C1COCCN1CC2=CC=C(C=C2)COC3=NC=CC(=N3)C(C#N)C4=NC5=CC=CC=C5S4 |
Computed by PubChem (NCBI)