Products 848409-34-7

CAS 848409-34-7 appears in our catalog under these names: 2,6-Dihydroxybenzeneboronic acid, 95%, (2,6-Dihydroxyphenyl)boronic acid, >95%, >95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

(2,6-dihydroxyphenyl)boronic acid (CAS 848409-34-7) is a chemical compound with the molecular formula C6H7BO4 and a molecular weight of 153.93 g/mol. IUPAC name: (2,6-dihydroxyphenyl)boronic acid. InChIKey: ACIZIJMWGZWBDP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7BO4
Molecular weight153.93 g/mol
IUPAC name(2,6-dihydroxyphenyl)boronic acid
InChIKeyACIZIJMWGZWBDP-UHFFFAOYSA-N
SMILESB(C1=C(C=CC=C1O)O)(O)O

Computed by PubChem (NCBI)