CAS 848416-48-8 is the registry number for tert-Butyl (3S,4S)-3-(bromomethyl)-4-fluoropyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3S,4S)-3-(bromomethyl)-4-fluoropyrrolidine-1-carboxylate (CAS 848416-48-8) is a chemical compound with the molecular formula C10H17BrFNO2 and a molecular weight of 282.15 g/mol. IUPAC name: tert-butyl (3S,4S)-3-(bromomethyl)-4-fluoropyrrolidine-1-carboxylate. InChIKey: FILZGHVWTGNLHC-JGVFFNPUSA-N.
| Molecular formula | C10H17BrFNO2 |
|---|---|
| Molecular weight | 282.15 g/mol |
| IUPAC name | tert-butyl (3S,4S)-3-(bromomethyl)-4-fluoropyrrolidine-1-carboxylate |
| InChIKey | FILZGHVWTGNLHC-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@@H](C1)F)CBr |
Computed by PubChem (NCBI)