CAS 848470-14-4 appears in our catalog under these names: 4-Amino-2,6-dibromo-3-nitropyridine, 95%, 2,6-Dibromo-3-nitropyridin-4-amine 97%, 2,6-Dibromo-3-nitropyridin-4-amine, 97%, 2,6-Dibromo-3-nitropyridin-4-amine, 97%, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
2,6-dibromo-3-nitropyridin-4-amine (CAS 848470-14-4) is a chemical compound with the molecular formula C5H3Br2N3O2 and a molecular weight of 296.90 g/mol. IUPAC name: 2,6-dibromo-3-nitropyridin-4-amine. InChIKey: KIELQQMDXWZGKC-UHFFFAOYSA-N.
| Molecular formula | C5H3Br2N3O2 |
|---|---|
| Molecular weight | 296.90 g/mol |
| IUPAC name | 2,6-dibromo-3-nitropyridin-4-amine |
| InChIKey | KIELQQMDXWZGKC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Br)Br)[N+](=O)[O-])N |
Computed by PubChem (NCBI)