Products 848498-90-8

CAS 848498-90-8 is the registry number for tert-Butyl N-(1-carbamothioylpiperidin-4-yl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(1-carbamothioylpiperidin-4-yl)carbamate (CAS 848498-90-8) is a chemical compound with the molecular formula C11H21N3O2S and a molecular weight of 259.37 g/mol. IUPAC name: tert-butyl N-(1-carbamothioylpiperidin-4-yl)carbamate. InChIKey: UQYHBRIBFPNSTA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H21N3O2S
Molecular weight259.37 g/mol
IUPAC nametert-butyl N-(1-carbamothioylpiperidin-4-yl)carbamate
InChIKeyUQYHBRIBFPNSTA-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CCN(CC1)C(=S)N

Computed by PubChem (NCBI)